C13H17N — CID 91477460
2-(2,3-dimethylcyclopenten-1-yl)aniline (PubChem CID 91477460) has the molecular formula C13H17N and a molecular weight of 187.29 g/mol. Its IUPAC name is 2-(2,3-dimethylcyclopenten-1-yl)aniline.
| Compound Name | 2-(2,3-dimethylcyclopenten-1-yl)aniline |
|---|---|
| PubChem CID | 91477460 |
| Molecular Formula | C13H17N |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | 2-(2,3-dimethylcyclopenten-1-yl)aniline |
| SMILES | CC1=C(c2ccccc2N)CCC1C |
| InChI | InChI=1S/C13H17N/c1-9-7-8-11(10(9)2)12-5-3-4-6-13(12)14/h3-6,9H,7-8,14H2,1-2H3 |
| InChIKey | LXKZESOZDSIQNC-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|