C12H15N — CID 166775887
4-[(3S)-2,3-dimethylcyclopenten-1-yl]pyridine (PubChem CID 166775887) has the molecular formula C12H15N and a molecular weight of 173.26 g/mol. Its IUPAC name is 4-[(3S)-2,3-dimethylcyclopenten-1-yl]pyridine.
| Compound Name | 4-[(3S)-2,3-dimethylcyclopenten-1-yl]pyridine |
|---|---|
| PubChem CID | 166775887 |
| Molecular Formula | C12H15N |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | 4-[(3S)-2,3-dimethylcyclopenten-1-yl]pyridine |
| SMILES | CC1=C(c2ccncc2)CC[C@@H]1C |
| InChI | InChI=1S/C12H15N/c1-9-3-4-12(10(9)2)11-5-7-13-8-6-11/h5-9H,3-4H2,1-2H3/t9-/m0/s1 |
| InChIKey | DIJYORHMAPYKDF-VIFPVBQESA-N |
| XLogP | 3.29 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |