About ethane;(5S)-5-methyl-6,7-dihydro-5H-cyclopenta[c]pyridine
ethane;(5S)-5-methyl-6,7-dihydro-5H-cyclopenta[c]pyridine (PubChem CID 170960546) has the molecular formula C11H17N
and a molecular weight of 163.26 g/mol. Its IUPAC name is ethane;(5S)-5-methyl-6,7-dihydro-5H-cyclopenta[c]pyridine.
Molecular Properties
| Compound Name | ethane;(5S)-5-methyl-6,7-dihydro-5H-cyclopenta[c]pyridine |
| PubChem CID | 170960546 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | ethane;(5S)-5-methyl-6,7-dihydro-5H-cyclopenta[c]pyridine |
| SMILES | CC.C[C@H]1CCc2cnccc21 |
| InChI | InChI=1S/C9H11N.C2H6/c1-7-2-3-8-6-10-5-4-9(7)8;1-2/h4-7H,2-3H2,1H3;1-2H3/t7-;/m0./s1 |
| InChIKey | VRGPWKKFBMZCHC-FJXQXJEOSA-N |
| XLogP | 3.16 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;(5S)-5-methyl-6,7-dihydro-5H-cyclopenta[c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(5S)-5-methyl-6,7-dihydro-5H-cyclopenta[c]pyridine?
The IUPAC name of ethane;(5S)-5-methyl-6,7-dihydro-5H-cyclopenta[c]pyridine (CID 170960546) is ethane;(5S)-5-methyl-6,7-dihydro-5H-cyclopenta[c]pyridine.
What is the SMILES notation for ethane;(5S)-5-methyl-6,7-dihydro-5H-cyclopenta[c]pyridine?
The canonical SMILES for ethane;(5S)-5-methyl-6,7-dihydro-5H-cyclopenta[c]pyridine is CC.C[C@H]1CCc2cnccc21.
What is the InChIKey of ethane;(5S)-5-methyl-6,7-dihydro-5H-cyclopenta[c]pyridine?
The InChIKey is VRGPWKKFBMZCHC-FJXQXJEOSA-N. The full InChI is InChI=1S/C9H11N.C2H6/c1-7-2-3-8-6-10-5-4-9(7)8;1-2/h4-7H,2-3H2,1H3;1-2H3/t7-;/m0./s1.
What are the key properties of ethane;(5S)-5-methyl-6,7-dihydro-5H-cyclopenta[c]pyridine?
ethane;(5S)-5-methyl-6,7-dihydro-5H-cyclopenta[c]pyridine has a molecular weight of 163.26 g/mol, XLogP of 3.16, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(5S)-5-methyl-6,7-dihydro-5H-cyclopenta[c]pyridine is sourced from PubChem (CID 170960546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).