C11H18N2 — CID 143028453
ethane;4-methyl-1,2,3,4-tetrahydro-1,7-naphthyridine (PubChem CID 143028453) has the molecular formula C11H18N2 and a molecular weight of 178.28 g/mol. Its IUPAC name is ethane;4-methyl-1,2,3,4-tetrahydro-1,7-naphthyridine.
| Compound Name | ethane;4-methyl-1,2,3,4-tetrahydro-1,7-naphthyridine |
|---|---|
| PubChem CID | 143028453 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | ethane;4-methyl-1,2,3,4-tetrahydro-1,7-naphthyridine |
| SMILES | CC.CC1CCNc2cnccc21 |
| InChI | InChI=1S/C9H12N2.C2H6/c1-7-2-5-11-9-6-10-4-3-8(7)9;1-2/h3-4,6-7,11H,2,5H2,1H3;1-2H3 |
| InChIKey | XWMUFSQCEQLYSJ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |