C9H11FN2 — CID 142484636
6-fluoro-4-methyl-1,2,3,4-tetrahydro-1,5-naphthyridine (PubChem CID 142484636) has the molecular formula C9H11FN2 and a molecular weight of 166.20 g/mol. Its IUPAC name is 6-fluoro-4-methyl-1,2,3,4-tetrahydro-1,5-naphthyridine.
| Compound Name | 6-fluoro-4-methyl-1,2,3,4-tetrahydro-1,5-naphthyridine |
|---|---|
| PubChem CID | 142484636 |
| Molecular Formula | C9H11FN2 |
| Molecular Weight | 166.20 g/mol |
| Exact Mass | 166.09 |
| IUPAC Name | 6-fluoro-4-methyl-1,2,3,4-tetrahydro-1,5-naphthyridine |
| SMILES | CC1CCNc2ccc(F)nc21 |
| InChI | InChI=1S/C9H11FN2/c1-6-4-5-11-7-2-3-8(10)12-9(6)7/h2-3,6,11H,4-5H2,1H3 |
| InChIKey | CUNFXKNUXJCNMA-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.20 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|