C7H8FN3 — CID 131699529
6-fluoro-1,2,3,4-tetrahydropyrido[2,3-b]pyrazine (PubChem CID 131699529) has the molecular formula C7H8FN3 and a molecular weight of 153.16 g/mol. Its IUPAC name is 6-fluoro-1,2,3,4-tetrahydropyrido[2,3-b]pyrazine.
| Compound Name | 6-fluoro-1,2,3,4-tetrahydropyrido[2,3-b]pyrazine |
|---|---|
| PubChem CID | 131699529 |
| Molecular Formula | C7H8FN3 |
| Molecular Weight | 153.16 g/mol |
| Exact Mass | 153.07 |
| IUPAC Name | 6-fluoro-1,2,3,4-tetrahydropyrido[2,3-b]pyrazine |
| SMILES | Fc1ccc2c(n1)NCCN2 |
| InChI | InChI=1S/C7H8FN3/c8-6-2-1-5-7(11-6)10-4-3-9-5/h1-2,9H,3-4H2,(H,10,11) |
| InChIKey | DWZKNXWPSQACGW-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.16 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|