C8H14N2 — CID 143824741
molecular hydrogen;1,2,3,4-tetrahydroquinoxaline (PubChem CID 143824741) has the molecular formula C8H14N2 and a molecular weight of 138.21 g/mol. Its IUPAC name is molecular hydrogen;1,2,3,4-tetrahydroquinoxaline.
| Compound Name | molecular hydrogen;1,2,3,4-tetrahydroquinoxaline |
|---|---|
| PubChem CID | 143824741 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | molecular hydrogen;1,2,3,4-tetrahydroquinoxaline |
| SMILES | [H][H].[H][H].c1ccc2c(c1)NCCN2 |
| InChI | InChI=1S/C8H10N2.2H2/c1-2-4-8-7(3-1)9-5-6-10-8;;/h1-4,9-10H,5-6H2;2*1H |
| InChIKey | IRDKFUWHEWUJRF-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_C(2)', 'substructure': 'N/A'} |
|---|