C10H14N2 — CID 2771763
1,2,3,4,5,6-hexahydro-1,6-benzodiazocine (PubChem CID 2771763) has the molecular formula C10H14N2 and a molecular weight of 162.24 g/mol. Its IUPAC name is 1,2,3,4,5,6-hexahydro-1,6-benzodiazocine.
| Compound Name | 1,2,3,4,5,6-hexahydro-1,6-benzodiazocine |
|---|---|
| PubChem CID | 2771763 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | 1,2,3,4,5,6-hexahydro-1,6-benzodiazocine |
| SMILES | c1ccc2c(c1)NCCCCN2 |
| InChI | InChI=1S/C10H14N2/c1-2-6-10-9(5-1)11-7-3-4-8-12-10/h1-2,5-6,11-12H,3-4,7-8H2 |
| InChIKey | RFRZYBRMESKXKP-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_C(2)', 'substructure': 'N/A'} |
|---|