C14H22N2 — CID 14892737
2,10-diazabicyclo[10.4.0]hexadeca-1(16),12,14-triene (PubChem CID 14892737) has the molecular formula C14H22N2 and a molecular weight of 218.34 g/mol. Its IUPAC name is 2,10-diazabicyclo[10.4.0]hexadeca-1(16),12,14-triene.
| Compound Name | 2,10-diazabicyclo[10.4.0]hexadeca-1(16),12,14-triene |
|---|---|
| PubChem CID | 14892737 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | 2,10-diazabicyclo[10.4.0]hexadeca-1(16),12,14-triene |
| SMILES | c1ccc2c(c1)CNCCCCCCCN2 |
| InChI | InChI=1S/C14H22N2/c1-2-6-10-15-12-13-8-4-5-9-14(13)16-11-7-3-1/h4-5,8-9,15-16H,1-3,6-7,10-12H2 |
| InChIKey | ICOLXVABWGTAHQ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |