C26H40N4O5 — CID 11283208
5,8,21,24,27-pentaoxa-2,11,18,30-tetrazatricyclo[29.4.0.012,17]pentatriaconta-1(35),12,14,16,31,33-hexaene (PubChem CID 11283208) has the molecular formula C26H40N4O5 and a molecular weight of 488.63 g/mol. Its IUPAC name is 5,8,21,24,27-pentaoxa-2,11,18,30-tetrazatricyclo[29.4.0.012,17]pentatriaconta-1(35),12,14,16,31,33-hexaene.
| Compound Name | 5,8,21,24,27-pentaoxa-2,11,18,30-tetrazatricyclo[29.4.0.012,17]pentatriaconta-1(35),12,14,16,31,33-hexaene |
|---|---|
| PubChem CID | 11283208 |
| Molecular Formula | C26H40N4O5 |
| Molecular Weight | 488.63 g/mol |
| Exact Mass | 488.30 |
| IUPAC Name | 5,8,21,24,27-pentaoxa-2,11,18,30-tetrazatricyclo[29.4.0.012,17]pentatriaconta-1(35),12,14,16,31,33-hexaene |
| SMILES | c1ccc2c(c1)NCCOCCOCCNc1ccccc1NCCOCCOCCOCCN2 |
| InChI | InChI=1S/C26H40N4O5/c1-3-7-25-23(5-1)27-9-13-31-17-18-32-14-10-28-24-6-2-4-8-26(24)30-12-16-34-20-22-35-21-19-33-15-11-29-25/h1-8,27-30H,9-22H2 |
| InChIKey | FORUZPCWLWEYIH-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 94.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.63 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_C(2)', 'substructure': 'N/A'} |
|---|