C13H20N2O — CID 67874658
morpholine;1,2,3,4-tetrahydroquinoline (PubChem CID 67874658) has the molecular formula C13H20N2O and a molecular weight of 220.32 g/mol. Its IUPAC name is morpholine;1,2,3,4-tetrahydroquinoline.
| Compound Name | morpholine;1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 67874658 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | morpholine;1,2,3,4-tetrahydroquinoline |
| SMILES | C1COCCN1.c1ccc2c(c1)CCCN2 |
| InChI | InChI=1S/C9H11N.C4H9NO/c1-2-6-9-8(4-1)5-3-7-10-9;1-3-6-4-2-5-1/h1-2,4,6,10H,3,5,7H2;5H,1-4H2 |
| InChIKey | IJWJFEFHVLRLEF-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |