C12H15NO4 — CID 66986458
propanedioic acid;1,2,3,4-tetrahydroquinoline (PubChem CID 66986458) has the molecular formula C12H15NO4 and a molecular weight of 237.25 g/mol. Its IUPAC name is propanedioic acid;1,2,3,4-tetrahydroquinoline.
| Compound Name | propanedioic acid;1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 66986458 |
| Molecular Formula | C12H15NO4 |
| Molecular Weight | 237.25 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | propanedioic acid;1,2,3,4-tetrahydroquinoline |
| SMILES | O=C(O)CC(=O)O.c1ccc2c(c1)CCCN2 |
| InChI | InChI=1S/C9H11N.C3H4O4/c1-2-6-9-8(4-1)5-3-7-10-9;4-2(5)1-3(6)7/h1-2,4,6,10H,3,5,7H2;1H2,(H,4,5)(H,6,7) |
| InChIKey | ASKXVZVOCGTOLC-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.25 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|