C11H15NO2 — CID 160533023
2,3-dihydro-1H-indole;methyl acetate (PubChem CID 160533023) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is 2,3-dihydro-1H-indole;methyl acetate.
| Compound Name | 2,3-dihydro-1H-indole;methyl acetate |
|---|---|
| PubChem CID | 160533023 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | 2,3-dihydro-1H-indole;methyl acetate |
| SMILES | COC(C)=O.c1ccc2c(c1)CCN2 |
| InChI | InChI=1S/C8H9N.C3H6O2/c1-2-4-8-7(3-1)5-6-9-8;1-3(4)5-2/h1-4,9H,5-6H2;1-2H3 |
| InChIKey | QVUKBHWSGPFLEA-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |