C17H20N2 — CID 159567822
2,3-dihydro-1H-indole;1,2,3,4-tetrahydroisoquinoline (PubChem CID 159567822) has the molecular formula C17H20N2 and a molecular weight of 252.36 g/mol. Its IUPAC name is 2,3-dihydro-1H-indole;1,2,3,4-tetrahydroisoquinoline.
| Compound Name | 2,3-dihydro-1H-indole;1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 159567822 |
| Molecular Formula | C17H20N2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | 2,3-dihydro-1H-indole;1,2,3,4-tetrahydroisoquinoline |
| SMILES | c1ccc2c(c1)CCN2.c1ccc2c(c1)CCNC2 |
| InChI | InChI=1S/C9H11N.C8H9N/c1-2-4-9-7-10-6-5-8(9)3-1;1-2-4-8-7(3-1)5-6-9-8/h1-4,10H,5-7H2;1-4,9H,5-6H2 |
| InChIKey | MHKUAGYWOAVBPV-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |