About 1,2,3,4-tetrahydroisoquinoline;hydroiodide
1,2,3,4-tetrahydroisoquinoline;hydroiodide (PubChem CID 141050859) has the molecular formula C9H12IN
and a molecular weight of 261.11 g/mol. Its IUPAC name is 1,2,3,4-tetrahydroisoquinoline;hydroiodide.
Molecular Properties
| Compound Name | 1,2,3,4-tetrahydroisoquinoline;hydroiodide |
| PubChem CID | 141050859 |
| Molecular Formula | C9H12IN |
| Molecular Weight | 261.11 g/mol |
| Exact Mass | 261.00 |
| IUPAC Name | 1,2,3,4-tetrahydroisoquinoline;hydroiodide |
| SMILES | I.c1ccc2c(c1)CCNC2 |
| InChI | InChI=1S/C9H11N.HI/c1-2-4-9-7-10-6-5-8(9)3-1;/h1-4,10H,5-7H2;1H |
| InChIKey | XRJZKHBBXPSWLM-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.11 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1,2,3,4-tetrahydroisoquinoline;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,3,4-tetrahydroisoquinoline;hydroiodide?
The IUPAC name of 1,2,3,4-tetrahydroisoquinoline;hydroiodide (CID 141050859) is 1,2,3,4-tetrahydroisoquinoline;hydroiodide.
What is the SMILES notation for 1,2,3,4-tetrahydroisoquinoline;hydroiodide?
The canonical SMILES for 1,2,3,4-tetrahydroisoquinoline;hydroiodide is I.c1ccc2c(c1)CCNC2.
What is the InChIKey of 1,2,3,4-tetrahydroisoquinoline;hydroiodide?
The InChIKey is XRJZKHBBXPSWLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N.HI/c1-2-4-9-7-10-6-5-8(9)3-1;/h1-4,10H,5-7H2;1H.
What are the key properties of 1,2,3,4-tetrahydroisoquinoline;hydroiodide?
1,2,3,4-tetrahydroisoquinoline;hydroiodide has a molecular weight of 261.11 g/mol, XLogP of 1.95, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,3,4-tetrahydroisoquinoline;hydroiodide is sourced from PubChem (CID 141050859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).