C9H12IN — CID 141050859
1,2,3,4-tetrahydroisoquinoline;hydroiodide (PubChem CID 141050859) has the molecular formula C9H12IN and a molecular weight of 261.11 g/mol. Its IUPAC name is 1,2,3,4-tetrahydroisoquinoline;hydroiodide.
| Compound Name | 1,2,3,4-tetrahydroisoquinoline;hydroiodide |
|---|---|
| PubChem CID | 141050859 |
| Molecular Formula | C9H12IN |
| Molecular Weight | 261.11 g/mol |
| Exact Mass | 261.00 |
| IUPAC Name | 1,2,3,4-tetrahydroisoquinoline;hydroiodide |
| SMILES | I.c1ccc2c(c1)CCNC2 |
| InChI | InChI=1S/C9H11N.HI/c1-2-4-9-7-10-6-5-8(9)3-1;/h1-4,10H,5-7H2;1H |
| InChIKey | XRJZKHBBXPSWLM-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.11 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|