C14H15N — CID 161490745
benzene;2,3-dihydro-1H-isoindole (PubChem CID 161490745) has the molecular formula C14H15N and a molecular weight of 197.28 g/mol. Its IUPAC name is benzene;2,3-dihydro-1H-isoindole.
| Compound Name | benzene;2,3-dihydro-1H-isoindole |
|---|---|
| PubChem CID | 161490745 |
| Molecular Formula | C14H15N |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | benzene;2,3-dihydro-1H-isoindole |
| SMILES | c1ccc2c(c1)CNC2.c1ccccc1 |
| InChI | InChI=1S/C8H9N.C6H6/c1-2-4-8-6-9-5-7(8)3-1;1-2-4-6-5-3-1/h1-4,9H,5-6H2;1-6H |
| InChIKey | WFONXEBMXFXCAZ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |