C14H25N — CID 145125160
ethane;2,3,4,5-tetrahydro-1H-2-benzazepine (PubChem CID 145125160) has the molecular formula C14H25N and a molecular weight of 207.36 g/mol. Its IUPAC name is ethane;2,3,4,5-tetrahydro-1H-2-benzazepine.
| Compound Name | ethane;2,3,4,5-tetrahydro-1H-2-benzazepine |
|---|---|
| PubChem CID | 145125160 |
| Molecular Formula | C14H25N |
| Molecular Weight | 207.36 g/mol |
| Exact Mass | 207.20 |
| IUPAC Name | ethane;2,3,4,5-tetrahydro-1H-2-benzazepine |
| SMILES | CC.CC.c1ccc2c(c1)CCCNC2 |
| InChI | InChI=1S/C10H13N.2C2H6/c1-2-5-10-8-11-7-3-6-9(10)4-1;2*1-2/h1-2,4-5,11H,3,6-8H2;2*1-2H3 |
| InChIKey | KXEAISSUSSCUSM-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.36 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |