About azepane;1,2,3,4-tetrahydroisoquinoline
azepane;1,2,3,4-tetrahydroisoquinoline (PubChem CID 67675496) has the molecular formula C15H24N2
and a molecular weight of 232.37 g/mol. Its IUPAC name is azepane;1,2,3,4-tetrahydroisoquinoline.
Molecular Properties
| Compound Name | azepane;1,2,3,4-tetrahydroisoquinoline |
| PubChem CID | 67675496 |
| Molecular Formula | C15H24N2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.19 |
| IUPAC Name | azepane;1,2,3,4-tetrahydroisoquinoline |
| SMILES | C1CCCNCC1.c1ccc2c(c1)CCNC2 |
| InChI | InChI=1S/C9H11N.C6H13N/c1-2-4-9-7-10-6-5-8(9)3-1;1-2-4-6-7-5-3-1/h1-4,10H,5-7H2;7H,1-6H2 |
| InChIKey | NORYQINMUXOYHD-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze azepane;1,2,3,4-tetrahydroisoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azepane;1,2,3,4-tetrahydroisoquinoline?
The IUPAC name of azepane;1,2,3,4-tetrahydroisoquinoline (CID 67675496) is azepane;1,2,3,4-tetrahydroisoquinoline.
What is the SMILES notation for azepane;1,2,3,4-tetrahydroisoquinoline?
The canonical SMILES for azepane;1,2,3,4-tetrahydroisoquinoline is C1CCCNCC1.c1ccc2c(c1)CCNC2.
What is the InChIKey of azepane;1,2,3,4-tetrahydroisoquinoline?
The InChIKey is NORYQINMUXOYHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N.C6H13N/c1-2-4-9-7-10-6-5-8(9)3-1;1-2-4-6-7-5-3-1/h1-4,10H,5-7H2;7H,1-6H2.
What are the key properties of azepane;1,2,3,4-tetrahydroisoquinoline?
azepane;1,2,3,4-tetrahydroisoquinoline has a molecular weight of 232.37 g/mol, XLogP of 2.48, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azepane;1,2,3,4-tetrahydroisoquinoline is sourced from PubChem (CID 67675496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).