C12H18N2 — CID 156519075
1,2,3,4,5,6,7,8-octahydro-3,6-benzodiazecine (PubChem CID 156519075) has the molecular formula C12H18N2 and a molecular weight of 190.29 g/mol. Its IUPAC name is 1,2,3,4,5,6,7,8-octahydro-3,6-benzodiazecine.
| Compound Name | 1,2,3,4,5,6,7,8-octahydro-3,6-benzodiazecine |
|---|---|
| PubChem CID | 156519075 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | 1,2,3,4,5,6,7,8-octahydro-3,6-benzodiazecine |
| SMILES | c1ccc2c(c1)CCNCCNCC2 |
| InChI | InChI=1S/C12H18N2/c1-2-4-12-6-8-14-10-9-13-7-5-11(12)3-1/h1-4,13-14H,5-10H2 |
| InChIKey | UEKKRROJPOMQDJ-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |