C18H24N2O4S — CID 175785291
sulfuric acid;bis(1,2,3,4-tetrahydroisoquinoline) (PubChem CID 175785291) has the molecular formula C18H24N2O4S and a molecular weight of 364.47 g/mol. Its IUPAC name is sulfuric acid;bis(1,2,3,4-tetrahydroisoquinoline).
| Compound Name | sulfuric acid;bis(1,2,3,4-tetrahydroisoquinoline) |
|---|---|
| PubChem CID | 175785291 |
| Molecular Formula | C18H24N2O4S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | sulfuric acid;bis(1,2,3,4-tetrahydroisoquinoline) |
| SMILES | O=S(=O)(O)O.c1ccc2c(c1)CCNC2.c1ccc2c(c1)CCNC2 |
| InChI | InChI=1S/2C9H11N.H2O4S/c2*1-2-4-9-7-10-6-5-8(9)3-1;1-5(2,3)4/h2*1-4,10H,5-7H2;(H2,1,2,3,4) |
| InChIKey | ADQGLJNMUVUBOQ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|