About azane;2,3-dihydro-1H-isoindole
azane;2,3-dihydro-1H-isoindole (PubChem CID 23342931) has the molecular formula C8H12N2
and a molecular weight of 136.20 g/mol. Its IUPAC name is azane;2,3-dihydro-1H-isoindole.
Molecular Properties
| Compound Name | azane;2,3-dihydro-1H-isoindole |
| PubChem CID | 23342931 |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 136.20 g/mol |
| Exact Mass | 136.10 |
| IUPAC Name | azane;2,3-dihydro-1H-isoindole |
| SMILES | N.c1ccc2c(c1)CNC2 |
| InChI | InChI=1S/C8H9N.H3N/c1-2-4-8-6-9-5-7(8)3-1;/h1-4,9H,5-6H2;1H3 |
| InChIKey | KDMGPKRIHXXFFW-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 47.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.20 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze azane;2,3-dihydro-1H-isoindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;2,3-dihydro-1H-isoindole?
The IUPAC name of azane;2,3-dihydro-1H-isoindole (CID 23342931) is azane;2,3-dihydro-1H-isoindole.
What is the SMILES notation for azane;2,3-dihydro-1H-isoindole?
The canonical SMILES for azane;2,3-dihydro-1H-isoindole is N.c1ccc2c(c1)CNC2.
What is the InChIKey of azane;2,3-dihydro-1H-isoindole?
The InChIKey is KDMGPKRIHXXFFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N.H3N/c1-2-4-8-6-9-5-7(8)3-1;/h1-4,9H,5-6H2;1H3.
What are the key properties of azane;2,3-dihydro-1H-isoindole?
azane;2,3-dihydro-1H-isoindole has a molecular weight of 136.20 g/mol, XLogP of 1.45, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azane;2,3-dihydro-1H-isoindole is sourced from PubChem (CID 23342931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).