About azane;2,3,4,5-tetrahydro-1H-3-benzazepine
azane;2,3,4,5-tetrahydro-1H-3-benzazepine (PubChem CID 135204749) has the molecular formula C10H16N2
and a molecular weight of 164.25 g/mol. Its IUPAC name is azane;2,3,4,5-tetrahydro-1H-3-benzazepine.
Molecular Properties
| Compound Name | azane;2,3,4,5-tetrahydro-1H-3-benzazepine |
| PubChem CID | 135204749 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | azane;2,3,4,5-tetrahydro-1H-3-benzazepine |
| SMILES | N.c1ccc2c(c1)CCNCC2 |
| InChI | InChI=1S/C10H13N.H3N/c1-2-4-10-6-8-11-7-5-9(10)3-1;/h1-4,11H,5-8H2;1H3 |
| InChIKey | BZJUSVJZJRYKKY-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 47.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze azane;2,3,4,5-tetrahydro-1H-3-benzazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;2,3,4,5-tetrahydro-1H-3-benzazepine?
The IUPAC name of azane;2,3,4,5-tetrahydro-1H-3-benzazepine (CID 135204749) is azane;2,3,4,5-tetrahydro-1H-3-benzazepine.
What is the SMILES notation for azane;2,3,4,5-tetrahydro-1H-3-benzazepine?
The canonical SMILES for azane;2,3,4,5-tetrahydro-1H-3-benzazepine is N.c1ccc2c(c1)CCNCC2.
What is the InChIKey of azane;2,3,4,5-tetrahydro-1H-3-benzazepine?
The InChIKey is BZJUSVJZJRYKKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N.H3N/c1-2-4-10-6-8-11-7-5-9(10)3-1;/h1-4,11H,5-8H2;1H3.
What are the key properties of azane;2,3,4,5-tetrahydro-1H-3-benzazepine?
azane;2,3,4,5-tetrahydro-1H-3-benzazepine has a molecular weight of 164.25 g/mol, XLogP of 1.54, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azane;2,3,4,5-tetrahydro-1H-3-benzazepine is sourced from PubChem (CID 135204749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).