C10H16N2 — CID 135204749
azane;2,3,4,5-tetrahydro-1H-3-benzazepine (PubChem CID 135204749) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is azane;2,3,4,5-tetrahydro-1H-3-benzazepine.
| Compound Name | azane;2,3,4,5-tetrahydro-1H-3-benzazepine |
|---|---|
| PubChem CID | 135204749 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | azane;2,3,4,5-tetrahydro-1H-3-benzazepine |
| SMILES | N.c1ccc2c(c1)CCNCC2 |
| InChI | InChI=1S/C10H13N.H3N/c1-2-4-10-6-8-11-7-5-9(10)3-1;/h1-4,11H,5-8H2;1H3 |
| InChIKey | BZJUSVJZJRYKKY-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 47.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |