C10H13N — CID 18719720
4,5,5-tritritio-1,2,3,4-tetrahydro-3-benzazepine (PubChem CID 18719720) has the molecular formula C10H13N and a molecular weight of 153.25 g/mol. Its IUPAC name is 4,5,5-tritritio-1,2,3,4-tetrahydro-3-benzazepine.
| Compound Name | 4,5,5-tritritio-1,2,3,4-tetrahydro-3-benzazepine |
|---|---|
| PubChem CID | 18719720 |
| Molecular Formula | C10H13N |
| Molecular Weight | 153.25 g/mol |
| Exact Mass | 153.13 |
| IUPAC Name | 4,5,5-tritritio-1,2,3,4-tetrahydro-3-benzazepine |
| SMILES | [3H]C1NCCc2ccccc2C1([3H])[3H] |
| InChI | InChI=1S/C10H13N/c1-2-4-10-6-8-11-7-5-9(10)3-1/h1-4,11H,5-8H2/i5T2,7T |
| InChIKey | MWVMYAWMFTVYED-WYKQUDHLSA-N |
| XLogP | 1.37 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.25 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |