C16H20N2 — CID 158445825
2,3-dihydro-1H-isoindole;N-methyl-1-phenylmethanamine (PubChem CID 158445825) has the molecular formula C16H20N2 and a molecular weight of 240.35 g/mol. Its IUPAC name is 2,3-dihydro-1H-isoindole;N-methyl-1-phenylmethanamine.
| Compound Name | 2,3-dihydro-1H-isoindole;N-methyl-1-phenylmethanamine |
|---|---|
| PubChem CID | 158445825 |
| Molecular Formula | C16H20N2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | 2,3-dihydro-1H-isoindole;N-methyl-1-phenylmethanamine |
| SMILES | CNCc1ccccc1.c1ccc2c(c1)CNC2 |
| InChI | InChI=1S/C8H9N.C8H11N/c1-2-4-8-6-9-5-7(8)3-1;1-9-7-8-5-3-2-4-6-8/h1-4,9H,5-6H2;2-6,9H,7H2,1H3 |
| InChIKey | HDJMKBAKCRUFSI-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |