C18H26N2 — CID 142094869
N-benzyl-N-methylethanamine;N-methyl-1-phenylmethanamine (PubChem CID 142094869) has the molecular formula C18H26N2 and a molecular weight of 270.42 g/mol. Its IUPAC name is N-benzyl-N-methylethanamine;N-methyl-1-phenylmethanamine.
| Compound Name | N-benzyl-N-methylethanamine;N-methyl-1-phenylmethanamine |
|---|---|
| PubChem CID | 142094869 |
| Molecular Formula | C18H26N2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.21 |
| IUPAC Name | N-benzyl-N-methylethanamine;N-methyl-1-phenylmethanamine |
| SMILES | CCN(C)Cc1ccccc1.CNCc1ccccc1 |
| InChI | InChI=1S/C10H15N.C8H11N/c1-3-11(2)9-10-7-5-4-6-8-10;1-9-7-8-5-3-2-4-6-8/h4-8H,3,9H2,1-2H3;2-6,9H,7H2,1H3 |
| InChIKey | XMAKAYHGOLVSKP-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |