About N-benzyl-N-methylcarbamoyl chloride;N-methyl-1-phenylmethanamine
N-benzyl-N-methylcarbamoyl chloride;N-methyl-1-phenylmethanamine (PubChem CID 167666361) has the molecular formula C17H21ClN2O
and a molecular weight of 304.82 g/mol. Its IUPAC name is N-benzyl-N-methylcarbamoyl chloride;N-methyl-1-phenylmethanamine.
Molecular Properties
| Compound Name | N-benzyl-N-methylcarbamoyl chloride;N-methyl-1-phenylmethanamine |
| PubChem CID | 167666361 |
| Molecular Formula | C17H21ClN2O |
| Molecular Weight | 304.82 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | N-benzyl-N-methylcarbamoyl chloride;N-methyl-1-phenylmethanamine |
| SMILES | CN(Cc1ccccc1)C(=O)Cl.CNCc1ccccc1 |
| InChI | InChI=1S/C9H10ClNO.C8H11N/c1-11(9(10)12)7-8-5-3-2-4-6-8;1-9-7-8-5-3-2-4-6-8/h2-6H,7H2,1H3;2-6,9H,7H2,1H3 |
| InChIKey | SRXREDFRUOCJGB-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.82 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze N-benzyl-N-methylcarbamoyl chloride;N-methyl-1-phenylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-N-methylcarbamoyl chloride;N-methyl-1-phenylmethanamine?
The IUPAC name of N-benzyl-N-methylcarbamoyl chloride;N-methyl-1-phenylmethanamine (CID 167666361) is N-benzyl-N-methylcarbamoyl chloride;N-methyl-1-phenylmethanamine.
What is the SMILES notation for N-benzyl-N-methylcarbamoyl chloride;N-methyl-1-phenylmethanamine?
The canonical SMILES for N-benzyl-N-methylcarbamoyl chloride;N-methyl-1-phenylmethanamine is CN(Cc1ccccc1)C(=O)Cl.CNCc1ccccc1.
What is the InChIKey of N-benzyl-N-methylcarbamoyl chloride;N-methyl-1-phenylmethanamine?
The InChIKey is SRXREDFRUOCJGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10ClNO.C8H11N/c1-11(9(10)12)7-8-5-3-2-4-6-8;1-9-7-8-5-3-2-4-6-8/h2-6H,7H2,1H3;2-6,9H,7H2,1H3.
What are the key properties of N-benzyl-N-methylcarbamoyl chloride;N-methyl-1-phenylmethanamine?
N-benzyl-N-methylcarbamoyl chloride;N-methyl-1-phenylmethanamine has a molecular weight of 304.82 g/mol, XLogP of 3.88, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-N-methylcarbamoyl chloride;N-methyl-1-phenylmethanamine is sourced from PubChem (CID 167666361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).