C26H34N2O — CID 160808532
N-benzyl-N-methylacetamide;ethylbenzene;N-methyl-1-phenylmethanamine (PubChem CID 160808532) has the molecular formula C26H34N2O and a molecular weight of 390.57 g/mol. Its IUPAC name is N-benzyl-N-methylacetamide;ethylbenzene;N-methyl-1-phenylmethanamine.
| Compound Name | N-benzyl-N-methylacetamide;ethylbenzene;N-methyl-1-phenylmethanamine |
|---|---|
| PubChem CID | 160808532 |
| Molecular Formula | C26H34N2O |
| Molecular Weight | 390.57 g/mol |
| Exact Mass | 390.27 |
| IUPAC Name | N-benzyl-N-methylacetamide;ethylbenzene;N-methyl-1-phenylmethanamine |
| SMILES | CC(=O)N(C)Cc1ccccc1.CCc1ccccc1.CNCc1ccccc1 |
| InChI | InChI=1S/C10H13NO.C8H11N.C8H10/c1-9(12)11(2)8-10-6-4-3-5-7-10;1-9-7-8-5-3-2-4-6-8;1-2-8-6-4-3-5-7-8/h3-7H,8H2,1-2H3;2-6,9H,7H2,1H3;3-7H,2H2,1H3 |
| InChIKey | SDZZTBITPMVIHT-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.57 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |