C18H38N2 — CID 159486837
N-benzyl-N-methylethanamine;N,N-dimethylethanamine;ethane (PubChem CID 159486837) has the molecular formula C18H38N2 and a molecular weight of 282.52 g/mol. Its IUPAC name is N-benzyl-N-methylethanamine;N,N-dimethylethanamine;ethane.
| Compound Name | N-benzyl-N-methylethanamine;N,N-dimethylethanamine;ethane |
|---|---|
| PubChem CID | 159486837 |
| Molecular Formula | C18H38N2 |
| Molecular Weight | 282.52 g/mol |
| Exact Mass | 282.30 |
| IUPAC Name | N-benzyl-N-methylethanamine;N,N-dimethylethanamine;ethane |
| SMILES | CC.CC.CCN(C)C.CCN(C)Cc1ccccc1 |
| InChI | InChI=1S/C10H15N.C4H11N.2C2H6/c1-3-11(2)9-10-7-5-4-6-8-10;1-4-5(2)3;2*1-2/h4-8H,3,9H2,1-2H3;4H2,1-3H3;2*1-2H3 |
| InChIKey | LXROAPIURRZUKD-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.52 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |