About 2,3-dihydro-1H-isoindole;ethane;tetrakis(1H-indole)
2,3-dihydro-1H-isoindole;ethane;tetrakis(1H-indole) (PubChem CID 159287838) has the molecular formula C50H67N5
and a molecular weight of 738.12 g/mol. Its IUPAC name is 2,3-dihydro-1H-isoindole;ethane;tetrakis(1H-indole).
Molecular Properties
| Compound Name | 2,3-dihydro-1H-isoindole;ethane;tetrakis(1H-indole) |
| PubChem CID | 159287838 |
| Molecular Formula | C50H67N5 |
| Molecular Weight | 738.12 g/mol |
| Exact Mass | 737.54 |
| IUPAC Name | 2,3-dihydro-1H-isoindole;ethane;tetrakis(1H-indole) |
| SMILES | CC.CC.CC.CC.CC.c1ccc2[nH]ccc2c1.c1ccc2[nH]ccc2c1.c1ccc2[nH]ccc2c1.c1ccc2[nH]ccc2c1.c1ccc2c(c1)CNC2 |
| InChI | InChI=1S/C8H9N.4C8H7N.5C2H6/c1-2-4-8-6-9-5-7(8)3-1;4*1-2-4-8-7(3-1)5-6-9-8;5*1-2/h1-4,9H,5-6H2;4*1-6,9H;5*1-2H3 |
| InChIKey | KZSUCJQUEGIXJW-UHFFFAOYSA-N |
| XLogP | 15.09 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 55 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 738.12 |
| LogP ≤ 5 | 15.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,3-dihydro-1H-isoindole;ethane;tetrakis(1H-indole) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydro-1H-isoindole;ethane;tetrakis(1H-indole)?
The IUPAC name of 2,3-dihydro-1H-isoindole;ethane;tetrakis(1H-indole) (CID 159287838) is 2,3-dihydro-1H-isoindole;ethane;tetrakis(1H-indole).
What is the SMILES notation for 2,3-dihydro-1H-isoindole;ethane;tetrakis(1H-indole)?
The canonical SMILES for 2,3-dihydro-1H-isoindole;ethane;tetrakis(1H-indole) is CC.CC.CC.CC.CC.c1ccc2[nH]ccc2c1.c1ccc2[nH]ccc2c1.c1ccc2[nH]ccc2c1.c1ccc2[nH]ccc2c1.c1ccc2c(c1)CNC2.
What is the InChIKey of 2,3-dihydro-1H-isoindole;ethane;tetrakis(1H-indole)?
The InChIKey is KZSUCJQUEGIXJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N.4C8H7N.5C2H6/c1-2-4-8-6-9-5-7(8)3-1;4*1-2-4-8-7(3-1)5-6-9-8;5*1-2/h1-4,9H,5-6H2;4*1-6,9H;5*1-2H3.
What are the key properties of 2,3-dihydro-1H-isoindole;ethane;tetrakis(1H-indole)?
2,3-dihydro-1H-isoindole;ethane;tetrakis(1H-indole) has a molecular weight of 738.12 g/mol, XLogP of 15.09, 0 rotatable bonds, 5 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydro-1H-isoindole;ethane;tetrakis(1H-indole) is sourced from PubChem (CID 159287838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).