About 5-phenyl-2,3-dihydro-1H-isoindole
5-phenyl-2,3-dihydro-1H-isoindole (PubChem CID 19691969) has the molecular formula C14H13N
and a molecular weight of 195.27 g/mol. Its IUPAC name is 5-phenyl-2,3-dihydro-1H-isoindole.
Molecular Properties
| Compound Name | 5-phenyl-2,3-dihydro-1H-isoindole |
| PubChem CID | 19691969 |
| Molecular Formula | C14H13N |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.10 |
| IUPAC Name | 5-phenyl-2,3-dihydro-1H-isoindole |
| SMILES | c1ccc(-c2ccc3c(c2)CNC3)cc1 |
| InChI | InChI=1S/C14H13N/c1-2-4-11(5-3-1)12-6-7-13-9-15-10-14(13)8-12/h1-8,15H,9-10H2 |
| InChIKey | SKFGGYSYEHRZCI-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-phenyl-2,3-dihydro-1H-isoindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-phenyl-2,3-dihydro-1H-isoindole?
The IUPAC name of 5-phenyl-2,3-dihydro-1H-isoindole (CID 19691969) is 5-phenyl-2,3-dihydro-1H-isoindole.
What is the SMILES notation for 5-phenyl-2,3-dihydro-1H-isoindole?
The canonical SMILES for 5-phenyl-2,3-dihydro-1H-isoindole is c1ccc(-c2ccc3c(c2)CNC3)cc1.
What is the InChIKey of 5-phenyl-2,3-dihydro-1H-isoindole?
The InChIKey is SKFGGYSYEHRZCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13N/c1-2-4-11(5-3-1)12-6-7-13-9-15-10-14(13)8-12/h1-8,15H,9-10H2.
What are the key properties of 5-phenyl-2,3-dihydro-1H-isoindole?
5-phenyl-2,3-dihydro-1H-isoindole has a molecular weight of 195.27 g/mol, XLogP of 2.96, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-phenyl-2,3-dihydro-1H-isoindole is sourced from PubChem (CID 19691969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).