C14H12N2O2 — CID 135218133
5-(3-nitrophenyl)-2,3-dihydro-1H-isoindole (PubChem CID 135218133) has the molecular formula C14H12N2O2 and a molecular weight of 240.26 g/mol. Its IUPAC name is 5-(3-nitrophenyl)-2,3-dihydro-1H-isoindole.
| Compound Name | 5-(3-nitrophenyl)-2,3-dihydro-1H-isoindole |
|---|---|
| PubChem CID | 135218133 |
| Molecular Formula | C14H12N2O2 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | 5-(3-nitrophenyl)-2,3-dihydro-1H-isoindole |
| SMILES | O=[N+]([O-])c1cccc(-c2ccc3c(c2)CNC3)c1 |
| InChI | InChI=1S/C14H12N2O2/c17-16(18)14-3-1-2-10(7-14)11-4-5-12-8-15-9-13(12)6-11/h1-7,15H,8-9H2 |
| InChIKey | HSHNHKJLBVBOBN-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|