C15H13N3O3 — CID 103997874
N-(3-nitrophenyl)-2,3-dihydro-1H-isoindole-5-carboxamide (PubChem CID 103997874) has the molecular formula C15H13N3O3 and a molecular weight of 283.29 g/mol. Its IUPAC name is N-(3-nitrophenyl)-2,3-dihydro-1H-isoindole-5-carboxamide.
| Compound Name | N-(3-nitrophenyl)-2,3-dihydro-1H-isoindole-5-carboxamide |
|---|---|
| PubChem CID | 103997874 |
| Molecular Formula | C15H13N3O3 |
| Molecular Weight | 283.29 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | N-(3-nitrophenyl)-2,3-dihydro-1H-isoindole-5-carboxamide |
| SMILES | O=C(Nc1cccc([N+](=O)[O-])c1)c1ccc2c(c1)CNC2 |
| InChI | InChI=1S/C15H13N3O3/c19-15(10-4-5-11-8-16-9-12(11)6-10)17-13-2-1-3-14(7-13)18(20)21/h1-7,16H,8-9H2,(H,17,19) |
| InChIKey | IBPNRVSKKZOHDI-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.29 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|