4-(2,3-dihydro-1H-isoindole-5-carbonylamino)benzoic acid

C16H14N2O3 — CID 115866991

IUPAC4-(2,3-dihydro-1H-isoindole-5-carbonylamino)benzoic acid
SMILESO=C(O)c1ccc(NC(=O)c2ccc3c(c2)CNC3)cc1
InChIInChI=1S/C16H14N2O3/c19-15(11-1-2-12-8-17-9-13(12)7-11)18-14-5-3-10(4-6-14)16(20)21/h1-7,17H,8-9H2,(H,18,19)(H,20,21)
InChIKeyTYROQVGXUUTAOP-UHFFFAOYSA-N
MW282.30 g/mol
LogP2.24
Rot. Bonds3

About 4-(2,3-dihydro-1H-isoindole-5-carbonylamino)benzoic acid

4-(2,3-dihydro-1H-isoindole-5-carbonylamino)benzoic acid (PubChem CID 115866991) has the molecular formula C16H14N2O3 and a molecular weight of 282.30 g/mol. Its IUPAC name is 4-(2,3-dihydro-1H-isoindole-5-carbonylamino)benzoic acid.

Molecular Properties

Compound Name4-(2,3-dihydro-1H-isoindole-5-carbonylamino)benzoic acid
PubChem CID115866991
Molecular FormulaC16H14N2O3
Molecular Weight282.30 g/mol
Exact Mass282.10
IUPAC Name4-(2,3-dihydro-1H-isoindole-5-carbonylamino)benzoic acid
SMILESO=C(O)c1ccc(NC(=O)c2ccc3c(c2)CNC3)cc1
InChIInChI=1S/C16H14N2O3/c19-15(11-1-2-12-8-17-9-13(12)7-11)18-14-5-3-10(4-6-14)16(20)21/h1-7,17H,8-9H2,(H,18,19)(H,20,21)
InChIKeyTYROQVGXUUTAOP-UHFFFAOYSA-N
XLogP2.24
TPSA78.43 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500282.30
LogP ≤ 52.24
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 4-(2,3-dihydro-1H-isoindole-5-carbonylamino)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(2,3-dihydro-1H-isoindole-5-carbonylamino)benzoic acid?
The IUPAC name of 4-(2,3-dihydro-1H-isoindole-5-carbonylamino)benzoic acid (CID 115866991) is 4-(2,3-dihydro-1H-isoindole-5-carbonylamino)benzoic acid.
What is the SMILES notation for 4-(2,3-dihydro-1H-isoindole-5-carbonylamino)benzoic acid?
The canonical SMILES for 4-(2,3-dihydro-1H-isoindole-5-carbonylamino)benzoic acid is O=C(O)c1ccc(NC(=O)c2ccc3c(c2)CNC3)cc1.
What is the InChIKey of 4-(2,3-dihydro-1H-isoindole-5-carbonylamino)benzoic acid?
The InChIKey is TYROQVGXUUTAOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N2O3/c19-15(11-1-2-12-8-17-9-13(12)7-11)18-14-5-3-10(4-6-14)16(20)21/h1-7,17H,8-9H2,(H,18,19)(H,20,21).
What are the key properties of 4-(2,3-dihydro-1H-isoindole-5-carbonylamino)benzoic acid?
4-(2,3-dihydro-1H-isoindole-5-carbonylamino)benzoic acid has a molecular weight of 282.30 g/mol, XLogP of 2.24, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,3-dihydro-1H-isoindole-5-carbonylamino)benzoic acid is sourced from PubChem (CID 115866991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).