2,3-dihydro-1H-isoindole-5-carboxylic acid;furan

C13H13NO3 — CID 146222356

IUPAC2,3-dihydro-1H-isoindole-5-carboxylic acid;furan
SMILESO=C(O)c1ccc2c(c1)CNC2.c1ccoc1
InChIInChI=1S/C9H9NO2.C4H4O/c11-9(12)6-1-2-7-4-10-5-8(7)3-6;1-2-4-5-3-1/h1-3,10H,4-5H2,(H,11,12);1-4H
InChIKeyJEUARJXVVLOCKQ-UHFFFAOYSA-N
MW231.25 g/mol
LogP2.27
Rot. Bonds1

About 2,3-dihydro-1H-isoindole-5-carboxylic acid;furan

2,3-dihydro-1H-isoindole-5-carboxylic acid;furan (PubChem CID 146222356) has the molecular formula C13H13NO3 and a molecular weight of 231.25 g/mol. Its IUPAC name is 2,3-dihydro-1H-isoindole-5-carboxylic acid;furan.

Molecular Properties

Compound Name2,3-dihydro-1H-isoindole-5-carboxylic acid;furan
PubChem CID146222356
Molecular FormulaC13H13NO3
Molecular Weight231.25 g/mol
Exact Mass231.09
IUPAC Name2,3-dihydro-1H-isoindole-5-carboxylic acid;furan
SMILESO=C(O)c1ccc2c(c1)CNC2.c1ccoc1
InChIInChI=1S/C9H9NO2.C4H4O/c11-9(12)6-1-2-7-4-10-5-8(7)3-6;1-2-4-5-3-1/h1-3,10H,4-5H2,(H,11,12);1-4H
InChIKeyJEUARJXVVLOCKQ-UHFFFAOYSA-N
XLogP2.27
TPSA62.47 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500231.25
LogP ≤ 52.27
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 2,3-dihydro-1H-isoindole-5-carboxylic acid;furan with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,3-dihydro-1H-isoindole-5-carboxylic acid;furan?
The IUPAC name of 2,3-dihydro-1H-isoindole-5-carboxylic acid;furan (CID 146222356) is 2,3-dihydro-1H-isoindole-5-carboxylic acid;furan.
What is the SMILES notation for 2,3-dihydro-1H-isoindole-5-carboxylic acid;furan?
The canonical SMILES for 2,3-dihydro-1H-isoindole-5-carboxylic acid;furan is O=C(O)c1ccc2c(c1)CNC2.c1ccoc1.
What is the InChIKey of 2,3-dihydro-1H-isoindole-5-carboxylic acid;furan?
The InChIKey is JEUARJXVVLOCKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO2.C4H4O/c11-9(12)6-1-2-7-4-10-5-8(7)3-6;1-2-4-5-3-1/h1-3,10H,4-5H2,(H,11,12);1-4H.
What are the key properties of 2,3-dihydro-1H-isoindole-5-carboxylic acid;furan?
2,3-dihydro-1H-isoindole-5-carboxylic acid;furan has a molecular weight of 231.25 g/mol, XLogP of 2.27, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydro-1H-isoindole-5-carboxylic acid;furan is sourced from PubChem (CID 146222356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).