C13H13NO3 — CID 146222356
2,3-dihydro-1H-isoindole-5-carboxylic acid;furan (PubChem CID 146222356) has the molecular formula C13H13NO3 and a molecular weight of 231.25 g/mol. Its IUPAC name is 2,3-dihydro-1H-isoindole-5-carboxylic acid;furan.
| Compound Name | 2,3-dihydro-1H-isoindole-5-carboxylic acid;furan |
|---|---|
| PubChem CID | 146222356 |
| Molecular Formula | C13H13NO3 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | 2,3-dihydro-1H-isoindole-5-carboxylic acid;furan |
| SMILES | O=C(O)c1ccc2c(c1)CNC2.c1ccoc1 |
| InChI | InChI=1S/C9H9NO2.C4H4O/c11-9(12)6-1-2-7-4-10-5-8(7)3-6;1-2-4-5-3-1/h1-3,10H,4-5H2,(H,11,12);1-4H |
| InChIKey | JEUARJXVVLOCKQ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |