C13H11NOS — CID 116613111
2,3-dihydro-1H-isoindol-5-yl(thiophen-2-yl)methanone (PubChem CID 116613111) has the molecular formula C13H11NOS and a molecular weight of 229.30 g/mol. Its IUPAC name is 2,3-dihydro-1H-isoindol-5-yl(thiophen-2-yl)methanone.
| Compound Name | 2,3-dihydro-1H-isoindol-5-yl(thiophen-2-yl)methanone |
|---|---|
| PubChem CID | 116613111 |
| Molecular Formula | C13H11NOS |
| Molecular Weight | 229.30 g/mol |
| Exact Mass | 229.06 |
| IUPAC Name | 2,3-dihydro-1H-isoindol-5-yl(thiophen-2-yl)methanone |
| SMILES | O=C(c1ccc2c(c1)CNC2)c1cccs1 |
| InChI | InChI=1S/C13H11NOS/c15-13(12-2-1-5-16-12)9-3-4-10-7-14-8-11(10)6-9/h1-6,14H,7-8H2 |
| InChIKey | COOFFLBQICSVHC-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.30 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |