[2-azaniumyl-4-(thiophene-2-carbonyl)phenyl]azanium chloride

C11H12ClN2OS+ — CID 131667569

IUPAC[2-azaniumyl-4-(thiophene-2-carbonyl)phenyl]azanium chloride
SMILES[Cl-].[NH3+]c1ccc(C(=O)c2cccs2)cc1[NH3+]
InChIInChI=1S/C11H10N2OS.ClH/c12-8-4-3-7(6-9(8)13)11(14)10-2-1-5-15-10;/h1-6H,12-13H2;1H/p+1
InChIKeyYGKYNZQJYDDBQJ-UHFFFAOYSA-O
MW255.75 g/mol
LogP-2.27
Rot. Bonds2

About [2-azaniumyl-4-(thiophene-2-carbonyl)phenyl]azanium chloride

[2-azaniumyl-4-(thiophene-2-carbonyl)phenyl]azanium chloride (PubChem CID 131667569) has the molecular formula C11H12ClN2OS+ and a molecular weight of 255.75 g/mol. Its IUPAC name is [2-azaniumyl-4-(thiophene-2-carbonyl)phenyl]azanium chloride.

Molecular Properties

Compound Name[2-azaniumyl-4-(thiophene-2-carbonyl)phenyl]azanium chloride
PubChem CID131667569
Molecular FormulaC11H12ClN2OS+
Molecular Weight255.75 g/mol
Exact Mass255.04
IUPAC Name[2-azaniumyl-4-(thiophene-2-carbonyl)phenyl]azanium chloride
SMILES[Cl-].[NH3+]c1ccc(C(=O)c2cccs2)cc1[NH3+]
InChIInChI=1S/C11H10N2OS.ClH/c12-8-4-3-7(6-9(8)13)11(14)10-2-1-5-15-10;/h1-6H,12-13H2;1H/p+1
InChIKeyYGKYNZQJYDDBQJ-UHFFFAOYSA-O
XLogP-2.27
TPSA72.35 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500255.75
LogP ≤ 5-2.27
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze [2-azaniumyl-4-(thiophene-2-carbonyl)phenyl]azanium chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [2-azaniumyl-4-(thiophene-2-carbonyl)phenyl]azanium chloride?
The IUPAC name of [2-azaniumyl-4-(thiophene-2-carbonyl)phenyl]azanium chloride (CID 131667569) is [2-azaniumyl-4-(thiophene-2-carbonyl)phenyl]azanium chloride.
What is the SMILES notation for [2-azaniumyl-4-(thiophene-2-carbonyl)phenyl]azanium chloride?
The canonical SMILES for [2-azaniumyl-4-(thiophene-2-carbonyl)phenyl]azanium chloride is [Cl-].[NH3+]c1ccc(C(=O)c2cccs2)cc1[NH3+].
What is the InChIKey of [2-azaniumyl-4-(thiophene-2-carbonyl)phenyl]azanium chloride?
The InChIKey is YGKYNZQJYDDBQJ-UHFFFAOYSA-O. The full InChI is InChI=1S/C11H10N2OS.ClH/c12-8-4-3-7(6-9(8)13)11(14)10-2-1-5-15-10;/h1-6H,12-13H2;1H/p+1.
What are the key properties of [2-azaniumyl-4-(thiophene-2-carbonyl)phenyl]azanium chloride?
[2-azaniumyl-4-(thiophene-2-carbonyl)phenyl]azanium chloride has a molecular weight of 255.75 g/mol, XLogP of -2.27, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [2-azaniumyl-4-(thiophene-2-carbonyl)phenyl]azanium chloride is sourced from PubChem (CID 131667569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).