C14H14O3S — CID 70586978
[4-(1,1-dihydroxypropan-2-yl)phenyl]-thiophen-2-ylmethanone (PubChem CID 70586978) has the molecular formula C14H14O3S and a molecular weight of 262.33 g/mol. Its IUPAC name is [4-(1,1-dihydroxypropan-2-yl)phenyl]-thiophen-2-ylmethanone.
| Compound Name | [4-(1,1-dihydroxypropan-2-yl)phenyl]-thiophen-2-ylmethanone |
|---|---|
| PubChem CID | 70586978 |
| Molecular Formula | C14H14O3S |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.07 |
| IUPAC Name | [4-(1,1-dihydroxypropan-2-yl)phenyl]-thiophen-2-ylmethanone |
| SMILES | CC(c1ccc(C(=O)c2cccs2)cc1)C(O)O |
| InChI | InChI=1S/C14H14O3S/c1-9(14(16)17)10-4-6-11(7-5-10)13(15)12-3-2-8-18-12/h2-9,14,16-17H,1H3 |
| InChIKey | CKHYDQQHYFZCNE-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|