C43H36N2O3S2 — CID 174482837
2,4-bis[9-ethyl-6-(thiophene-2-carbonyl)carbazol-3-yl]pentan-3-one (PubChem CID 174482837) has the molecular formula C43H36N2O3S2 and a molecular weight of 692.91 g/mol. Its IUPAC name is 2,4-bis[9-ethyl-6-(thiophene-2-carbonyl)carbazol-3-yl]pentan-3-one.
| Compound Name | 2,4-bis[9-ethyl-6-(thiophene-2-carbonyl)carbazol-3-yl]pentan-3-one |
|---|---|
| PubChem CID | 174482837 |
| Molecular Formula | C43H36N2O3S2 |
| Molecular Weight | 692.91 g/mol |
| Exact Mass | 692.22 |
| IUPAC Name | 2,4-bis[9-ethyl-6-(thiophene-2-carbonyl)carbazol-3-yl]pentan-3-one |
| SMILES | CCn1c2ccc(C(=O)c3cccs3)cc2c2cc(C(C)C(=O)C(C)c3ccc4c(c3)c3cc(C(=O)c5cccs5)ccc3n4CC)ccc21 |
| InChI | InChI=1S/C43H36N2O3S2/c1-5-44-35-15-11-27(21-31(35)33-23-29(13-17-37(33)44)42(47)39-9-7-19-49-39)25(3)41(46)26(4)28-12-16-36-32(22-28)34-24-30(14-18-38(34)45(36)6-2)43(48)40-10-8-20-50-40/h7-26H,5-6H2,1-4H3 |
| InChIKey | XMAMNHSILQCWBL-UHFFFAOYSA-N |
| XLogP | 11.00 |
| TPSA | 61.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.91 |
| LogP ≤ 5 | 11.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |