C23H20N2O3S — CID 89111826
[(E)-1-[9-ethyl-6-(thiophene-2-carbonyl)carbazol-3-yl]ethylideneamino] acetate (PubChem CID 89111826) has the molecular formula C23H20N2O3S and a molecular weight of 404.49 g/mol. Its IUPAC name is [(E)-1-[9-ethyl-6-(thiophene-2-carbonyl)carbazol-3-yl]ethylideneamino] acetate.
| Compound Name | [(E)-1-[9-ethyl-6-(thiophene-2-carbonyl)carbazol-3-yl]ethylideneamino] acetate |
|---|---|
| PubChem CID | 89111826 |
| Molecular Formula | C23H20N2O3S |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | [(E)-1-[9-ethyl-6-(thiophene-2-carbonyl)carbazol-3-yl]ethylideneamino] acetate |
| SMILES | CCn1c2ccc(C(=O)c3cccs3)cc2c2cc(/C(C)=N/OC(C)=O)ccc21 |
| InChI | InChI=1S/C23H20N2O3S/c1-4-25-20-9-7-16(14(2)24-28-15(3)26)12-18(20)19-13-17(8-10-21(19)25)23(27)22-6-5-11-29-22/h5-13H,4H2,1-3H3/b24-14+ |
| InChIKey | IXQIBZMFSXMFBJ-ZVHZXABRSA-N |
| XLogP | 5.39 |
| TPSA | 60.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|