C28H30N2O2S — CID 172920003
[(E)-1-[9-hexyl-6-(1-thiophen-2-ylethenyl)carbazol-3-yl]ethylideneamino] acetate (PubChem CID 172920003) has the molecular formula C28H30N2O2S and a molecular weight of 458.63 g/mol. Its IUPAC name is [(E)-1-[9-hexyl-6-(1-thiophen-2-ylethenyl)carbazol-3-yl]ethylideneamino] acetate.
| Compound Name | [(E)-1-[9-hexyl-6-(1-thiophen-2-ylethenyl)carbazol-3-yl]ethylideneamino] acetate |
|---|---|
| PubChem CID | 172920003 |
| Molecular Formula | C28H30N2O2S |
| Molecular Weight | 458.63 g/mol |
| Exact Mass | 458.20 |
| IUPAC Name | [(E)-1-[9-hexyl-6-(1-thiophen-2-ylethenyl)carbazol-3-yl]ethylideneamino] acetate |
| SMILES | C=C(c1ccc2c(c1)c1cc(/C(C)=N/OC(C)=O)ccc1n2CCCCCC)c1cccs1 |
| InChI | InChI=1S/C28H30N2O2S/c1-5-6-7-8-15-30-26-13-11-22(19(2)28-10-9-16-33-28)17-24(26)25-18-23(12-14-27(25)30)20(3)29-32-21(4)31/h9-14,16-18H,2,5-8,15H2,1,3-4H3/b29-20+ |
| InChIKey | PEMHZBAKYPBKBL-ZTKZIYFRSA-N |
| XLogP | 7.78 |
| TPSA | 43.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.63 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|