C30H38N2O — CID 144852312
(E)-1-[9-hexyl-6-[(2E,4Z)-2-methylhexa-2,4-dienyl]carbazol-3-yl]-N-prop-1-en-2-yloxyethanimine (PubChem CID 144852312) has the molecular formula C30H38N2O and a molecular weight of 442.65 g/mol. Its IUPAC name is (E)-1-[9-hexyl-6-[(2E,4Z)-2-methylhexa-2,4-dienyl]carbazol-3-yl]-N-prop-1-en-2-yloxyethanimine.
| Compound Name | (E)-1-[9-hexyl-6-[(2E,4Z)-2-methylhexa-2,4-dienyl]carbazol-3-yl]-N-prop-1-en-2-yloxyethanimine |
|---|---|
| PubChem CID | 144852312 |
| Molecular Formula | C30H38N2O |
| Molecular Weight | 442.65 g/mol |
| Exact Mass | 442.30 |
| IUPAC Name | (E)-1-[9-hexyl-6-[(2E,4Z)-2-methylhexa-2,4-dienyl]carbazol-3-yl]-N-prop-1-en-2-yloxyethanimine |
| SMILES | C=C(C)O/N=C(\C)c1ccc2c(c1)c1cc(C/C(C)=C/C=C\C)ccc1n2CCCCCC |
| InChI | InChI=1S/C30H38N2O/c1-7-9-11-12-18-32-29-16-14-25(19-23(5)13-10-8-2)20-27(29)28-21-26(15-17-30(28)32)24(6)31-33-22(3)4/h8,10,13-17,20-21H,3,7,9,11-12,18-19H2,1-2,4-6H3/b10-8-,23-13+,31-24+ |
| InChIKey | DXGJUXZZBJBCLT-YAYYBXGLSA-N |
| XLogP | 8.71 |
| TPSA | 26.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.65 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|