C22H25N3O4 — CID 76678136
[1-(9-hexyl-6-nitrocarbazol-3-yl)ethylideneamino] acetate (PubChem CID 76678136) has the molecular formula C22H25N3O4 and a molecular weight of 395.46 g/mol. Its IUPAC name is [1-(9-hexyl-6-nitrocarbazol-3-yl)ethylideneamino] acetate.
| Compound Name | [1-(9-hexyl-6-nitrocarbazol-3-yl)ethylideneamino] acetate |
|---|---|
| PubChem CID | 76678136 |
| Molecular Formula | C22H25N3O4 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | [1-(9-hexyl-6-nitrocarbazol-3-yl)ethylideneamino] acetate |
| SMILES | CCCCCCn1c2ccc(C(C)=NOC(C)=O)cc2c2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C22H25N3O4/c1-4-5-6-7-12-24-21-10-8-17(15(2)23-29-16(3)26)13-19(21)20-14-18(25(27)28)9-11-22(20)24/h8-11,13-14H,4-7,12H2,1-3H3 |
| InChIKey | RTXKHQXCUAKCHJ-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 86.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|