C29H30FN3O4 — CID 76678151
[[[9-(2-ethylhexyl)-6-nitrocarbazol-3-yl]-(4-fluorophenyl)methylidene]amino] acetate (PubChem CID 76678151) has the molecular formula C29H30FN3O4 and a molecular weight of 503.57 g/mol. Its IUPAC name is [[[9-(2-ethylhexyl)-6-nitrocarbazol-3-yl]-(4-fluorophenyl)methylidene]amino] acetate.
| Compound Name | [[[9-(2-ethylhexyl)-6-nitrocarbazol-3-yl]-(4-fluorophenyl)methylidene]amino] acetate |
|---|---|
| PubChem CID | 76678151 |
| Molecular Formula | C29H30FN3O4 |
| Molecular Weight | 503.57 g/mol |
| Exact Mass | 503.22 |
| IUPAC Name | [[[9-(2-ethylhexyl)-6-nitrocarbazol-3-yl]-(4-fluorophenyl)methylidene]amino] acetate |
| SMILES | CCCCC(CC)Cn1c2ccc(C(=NOC(C)=O)c3ccc(F)cc3)cc2c2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C29H30FN3O4/c1-4-6-7-20(5-2)18-32-27-14-10-22(16-25(27)26-17-24(33(35)36)13-15-28(26)32)29(31-37-19(3)34)21-8-11-23(30)12-9-21/h8-17,20H,4-7,18H2,1-3H3 |
| InChIKey | VIGMODQFIMHBNS-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 86.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.57 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|