C31H25N3O5 — CID 134392058
[(E)-[[9-ethyl-6-(2-methylbenzoyl)carbazol-3-yl]-(4-nitrophenyl)methylidene]amino] acetate (PubChem CID 134392058) has the molecular formula C31H25N3O5 and a molecular weight of 519.56 g/mol. Its IUPAC name is [(E)-[[9-ethyl-6-(2-methylbenzoyl)carbazol-3-yl]-(4-nitrophenyl)methylidene]amino] acetate.
| Compound Name | [(E)-[[9-ethyl-6-(2-methylbenzoyl)carbazol-3-yl]-(4-nitrophenyl)methylidene]amino] acetate |
|---|---|
| PubChem CID | 134392058 |
| Molecular Formula | C31H25N3O5 |
| Molecular Weight | 519.56 g/mol |
| Exact Mass | 519.18 |
| IUPAC Name | [(E)-[[9-ethyl-6-(2-methylbenzoyl)carbazol-3-yl]-(4-nitrophenyl)methylidene]amino] acetate |
| SMILES | CCn1c2ccc(C(=O)c3ccccc3C)cc2c2cc(/C(=N/OC(C)=O)c3ccc([N+](=O)[O-])cc3)ccc21 |
| InChI | InChI=1S/C31H25N3O5/c1-4-33-28-15-11-22(30(32-39-20(3)35)21-9-13-24(14-10-21)34(37)38)17-26(28)27-18-23(12-16-29(27)33)31(36)25-8-6-5-7-19(25)2/h5-18H,4H2,1-3H3/b32-30+ |
| InChIKey | YZFNWPWKGWJWJT-NHQGMKOOSA-N |
| XLogP | 6.58 |
| TPSA | 103.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.56 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|