C27H26N2O3 — CID 91545614
[(Z)-1-[6-(2,4-dimethylbenzoyl)-9-ethylcarbazol-3-yl]ethylideneamino] acetate (PubChem CID 91545614) has the molecular formula C27H26N2O3 and a molecular weight of 426.52 g/mol. Its IUPAC name is [(Z)-1-[6-(2,4-dimethylbenzoyl)-9-ethylcarbazol-3-yl]ethylideneamino] acetate.
| Compound Name | [(Z)-1-[6-(2,4-dimethylbenzoyl)-9-ethylcarbazol-3-yl]ethylideneamino] acetate |
|---|---|
| PubChem CID | 91545614 |
| Molecular Formula | C27H26N2O3 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | [(Z)-1-[6-(2,4-dimethylbenzoyl)-9-ethylcarbazol-3-yl]ethylideneamino] acetate |
| SMILES | CCn1c2ccc(C(=O)c3ccc(C)cc3C)cc2c2cc(/C(C)=N\OC(C)=O)ccc21 |
| InChI | InChI=1S/C27H26N2O3/c1-6-29-25-11-8-20(18(4)28-32-19(5)30)14-23(25)24-15-21(9-12-26(24)29)27(31)22-10-7-16(2)13-17(22)3/h7-15H,6H2,1-5H3/b28-18- |
| InChIKey | SOYPVISDCCVPCR-VEILYXNESA-N |
| XLogP | 5.95 |
| TPSA | 60.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|