C32H32N2O3 — CID 143868635
[(E)-1-[9-ethyl-6-(2-methylbenzoyl)carbazol-3-yl]pent-4-ynylideneamino] acetate;prop-1-ene (PubChem CID 143868635) has the molecular formula C32H32N2O3 and a molecular weight of 492.62 g/mol. Its IUPAC name is [(E)-1-[9-ethyl-6-(2-methylbenzoyl)carbazol-3-yl]pent-4-ynylideneamino] acetate;prop-1-ene.
| Compound Name | [(E)-1-[9-ethyl-6-(2-methylbenzoyl)carbazol-3-yl]pent-4-ynylideneamino] acetate;prop-1-ene |
|---|---|
| PubChem CID | 143868635 |
| Molecular Formula | C32H32N2O3 |
| Molecular Weight | 492.62 g/mol |
| Exact Mass | 492.24 |
| IUPAC Name | [(E)-1-[9-ethyl-6-(2-methylbenzoyl)carbazol-3-yl]pent-4-ynylideneamino] acetate;prop-1-ene |
| SMILES | C#CCC/C(=N\OC(C)=O)c1ccc2c(c1)c1cc(C(=O)c3ccccc3C)ccc1n2CC.C=CC |
| InChI | InChI=1S/C29H26N2O3.C3H6/c1-5-7-12-26(30-34-20(4)32)21-13-15-27-24(17-21)25-18-22(14-16-28(25)31(27)6-2)29(33)23-11-9-8-10-19(23)3;1-3-2/h1,8-11,13-18H,6-7,12H2,2-4H3;3H,1H2,2H3/b30-26+; |
| InChIKey | JIROYYRLNWVWCN-REAKUJNMSA-N |
| XLogP | 7.23 |
| TPSA | 60.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.62 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|