C27H25NO2 — CID 167229658
1-[9-ethyl-6-(2-methylbenzoyl)carbazol-3-yl]pent-4-en-1-one (PubChem CID 167229658) has the molecular formula C27H25NO2 and a molecular weight of 395.50 g/mol. Its IUPAC name is 1-[9-ethyl-6-(2-methylbenzoyl)carbazol-3-yl]pent-4-en-1-one.
| Compound Name | 1-[9-ethyl-6-(2-methylbenzoyl)carbazol-3-yl]pent-4-en-1-one |
|---|---|
| PubChem CID | 167229658 |
| Molecular Formula | C27H25NO2 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | 1-[9-ethyl-6-(2-methylbenzoyl)carbazol-3-yl]pent-4-en-1-one |
| SMILES | C=CCCC(=O)c1ccc2c(c1)c1cc(C(=O)c3ccccc3C)ccc1n2CC |
| InChI | InChI=1S/C27H25NO2/c1-4-6-11-26(29)19-12-14-24-22(16-19)23-17-20(13-15-25(23)28(24)5-2)27(30)21-10-8-7-9-18(21)3/h4,7-10,12-17H,1,5-6,11H2,2-3H3 |
| InChIKey | WIXRCRMUNUFMJM-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|