C27H28NOS+ — CID 59664422
[9-ethyl-6-(thiolan-1-ium-1-ylmethyl)carbazol-3-yl]-(2-methylphenyl)methanone (PubChem CID 59664422) has the molecular formula C27H28NOS+ and a molecular weight of 414.59 g/mol. Its IUPAC name is [9-ethyl-6-(thiolan-1-ium-1-ylmethyl)carbazol-3-yl]-(2-methylphenyl)methanone.
| Compound Name | [9-ethyl-6-(thiolan-1-ium-1-ylmethyl)carbazol-3-yl]-(2-methylphenyl)methanone |
|---|---|
| PubChem CID | 59664422 |
| Molecular Formula | C27H28NOS+ |
| Molecular Weight | 414.59 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | [9-ethyl-6-(thiolan-1-ium-1-ylmethyl)carbazol-3-yl]-(2-methylphenyl)methanone |
| SMILES | CCn1c2ccc(C[S+]3CCCC3)cc2c2cc(C(=O)c3ccccc3C)ccc21 |
| InChI | InChI=1S/C27H28NOS/c1-3-28-25-12-10-20(18-30-14-6-7-15-30)16-23(25)24-17-21(11-13-26(24)28)27(29)22-9-5-4-8-19(22)2/h4-5,8-13,16-17H,3,6-7,14-15,18H2,1-2H3/q+1 |
| InChIKey | DSYBJAUNNARDHP-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.59 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|