C21H23N3O4 — CID 76678117
[1-(6-nitro-9-pentylcarbazol-3-yl)ethylideneamino] acetate (PubChem CID 76678117) has the molecular formula C21H23N3O4 and a molecular weight of 381.43 g/mol. Its IUPAC name is [1-(6-nitro-9-pentylcarbazol-3-yl)ethylideneamino] acetate.
| Compound Name | [1-(6-nitro-9-pentylcarbazol-3-yl)ethylideneamino] acetate |
|---|---|
| PubChem CID | 76678117 |
| Molecular Formula | C21H23N3O4 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | [1-(6-nitro-9-pentylcarbazol-3-yl)ethylideneamino] acetate |
| SMILES | CCCCCn1c2ccc(C(C)=NOC(C)=O)cc2c2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C21H23N3O4/c1-4-5-6-11-23-20-9-7-16(14(2)22-28-15(3)25)12-18(20)19-13-17(24(26)27)8-10-21(19)23/h7-10,12-13H,4-6,11H2,1-3H3 |
| InChIKey | RLIUUJMZJQUKCN-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 86.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|