C26H35N3O8 — CID 143707923
ethane;methoxymethane;1-methoxypropan-2-yl 2-[3-[(E)-N-acetyloxy-C-methylcarbonimidoyl]-6-nitrocarbazol-9-yl]acetate (PubChem CID 143707923) has the molecular formula C26H35N3O8 and a molecular weight of 517.58 g/mol. Its IUPAC name is ethane;methoxymethane;1-methoxypropan-2-yl 2-[3-[(E)-N-acetyloxy-C-methylcarbonimidoyl]-6-nitrocarbazol-9-yl]acetate.
| Compound Name | ethane;methoxymethane;1-methoxypropan-2-yl 2-[3-[(E)-N-acetyloxy-C-methylcarbonimidoyl]-6-nitrocarbazol-9-yl]acetate |
|---|---|
| PubChem CID | 143707923 |
| Molecular Formula | C26H35N3O8 |
| Molecular Weight | 517.58 g/mol |
| Exact Mass | 517.24 |
| IUPAC Name | ethane;methoxymethane;1-methoxypropan-2-yl 2-[3-[(E)-N-acetyloxy-C-methylcarbonimidoyl]-6-nitrocarbazol-9-yl]acetate |
| SMILES | CC.COC.COCC(C)OC(=O)Cn1c2ccc(/C(C)=N/OC(C)=O)cc2c2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C22H23N3O7.C2H6O.C2H6/c1-13(12-30-4)31-22(27)11-24-20-7-5-16(14(2)23-32-15(3)26)9-18(20)19-10-17(25(28)29)6-8-21(19)24;1-3-2;1-2/h5-10,13H,11-12H2,1-4H3;1-2H3;1-2H3/b23-14+;; |
| InChIKey | WTABDEYSTCOQNV-PQZUSRQGSA-N |
| XLogP | 4.86 |
| TPSA | 131.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.58 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|